84963-36-0 Usage
Uses
Used in Organic Synthesis:
(E)-3-(2-Phenylvinyl)pyridine-2-carboxamide is used as an intermediate in the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (E)-3-(2-Phenylvinyl)pyridine-2-carboxamide is used as a starting material for the development of new drugs. Its potential biological activities and therapeutic properties make it a promising candidate for the treatment of various diseases and conditions.
Used in Drug Development:
(E)-3-(2-Phenylvinyl)pyridine-2-carboxamide is employed as a key component in the development of novel therapeutic agents. Its unique chemical structure and potential biological activities contribute to the design and synthesis of innovative drugs with improved efficacy and safety profiles.
Used in Biological Research:
In the field of biological research, (E)-3-(2-Phenylvinyl)pyridine-2-carboxamide is utilized as a tool to study various cellular processes and pathways. Its interaction with different biological targets can provide valuable insights into the underlying mechanisms of various diseases, ultimately leading to the development of targeted therapies.
Overall, (E)-3-(2-Phenylvinyl)pyridine-2-carboxamide is a versatile compound with a wide range of applications in various industries, including organic synthesis, pharmaceutical research, drug development, and biological research. Its unique properties and potential therapeutic applications make it a valuable asset in the ongoing quest for new and improved treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 84963-36-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,9,6 and 3 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 84963-36:
(7*8)+(6*4)+(5*9)+(4*6)+(3*3)+(2*3)+(1*6)=170
170 % 10 = 0
So 84963-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H12N2O/c15-14(17)13-12(7-4-10-16-13)9-8-11-5-2-1-3-6-11/h1-10H,(H2,15,17)/b9-8+
84963-36-0Relevant articles and documents
Preparation method of 3-(2-phenethyl)-2-pyridinecarboxamide compound
-
Paragraph 0037, (2018/04/01)
The invention discloses a preparation method of a 3-(2-phenethyl)-2-pyridinecarboxamide compound (I). The preparation method comprises the following steps: taking 2-cyano-3-methylpyridine and a benzaldehyde compound as starting raw materials, firstly performing a condensation reaction in an appropriate solvent and under an alkali condition to obtain a 3-(2-styryl)-2-pyridinecarboxamide compound, then performing a catalytic hydrogenation reaction on the intermediate to obtain the 3-(2-phenethyl)-2-pyridinecarboxamide compound (I).
