851386-35-1 Usage
Uses
Used in Pharmaceutical Industry:
5-Iodo-2,3-difluoropyridine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its ability to participate in a wide range of chemical reactions allows for the development of diverse medicinal products.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Iodo-2,3-difluoropyridine serves as a vital building block for the production of various agrochemicals. Its reactivity and stability contribute to the creation of effective compounds for agricultural applications.
Used in Fine Chemicals Industry:
5-Iodo-2,3-difluoropyridine is utilized as a versatile intermediate in the synthesis of fine chemicals. Its unique properties enable the production of high-quality specialty chemicals for various applications.
Used in Organic Synthesis Research:
As a valuable chemical in organic synthesis, 5-Iodo-2,3-difluoropyridine is employed in research to explore new chemical reactions and pathways. This contributes to the advancement of chemical knowledge and the development of innovative chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 851386-35-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,1,3,8 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 851386-35:
(8*8)+(7*5)+(6*1)+(5*3)+(4*8)+(3*6)+(2*3)+(1*5)=181
181 % 10 = 1
So 851386-35-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H2F2IN/c6-4-1-3(8)2-9-5(4)7/h1-2H
