854690-87-2 Usage
Uses
Used in Pharmaceutical Development:
3-Difluoromethyl-phenylboronic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds for its ability to improve the metabolic stability and lipophilicity of drugs, thereby potentially enhancing their efficacy and bioavailability.
Used in Agrochemical Synthesis:
In the agrochemical industry, 3-Difluoromethyl-phenylboronic acid is utilized as a building block for the creation of novel agrochemicals, leveraging its reactivity to form stable bonds that can contribute to the development of more effective and environmentally friendly products.
Used in Materials Science:
3-Difluoromethyl-phenylboronic acid is employed as a component in the development of advanced materials, where its capacity to form stable bonds is harnessed to create materials with improved properties for various applications, such as in electronics or coatings.
Used in Medicinal Chemistry Research:
As a valuable tool in medicinal chemistry, 3-Difluoromethyl-phenylboronic acid is used in research to explore and understand the effects of the difluoromethyl group on drug-target interactions, potentially leading to the design of drugs with superior binding affinity and selectivity for their intended targets.
Check Digit Verification of cas no
The CAS Registry Mumber 854690-87-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,4,6,9 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 854690-87:
(8*8)+(7*5)+(6*4)+(5*6)+(4*9)+(3*0)+(2*8)+(1*7)=212
212 % 10 = 2
So 854690-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BF2O2/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,7,11-12H
