85579-26-6 Usage
Explanation
The compound consists of 11 carbon (C), 8 hydrogen (H), 2 nitrogen (N), 3 oxygen (O), and 2 sulfur (S) atoms.
2. Heterocyclic compound
Explanation
It contains a ring structure with different elements (heteroatoms) such as nitrogen, oxygen, and sulfur, making it a heterocyclic compound.
3. Reactive nature
Explanation
The presence of oxygen and sulfur in its chemical structure makes the compound reactive, which can be useful in various chemical reactions.
4. Unique properties
Explanation
The complex structure of the compound suggests that it may have unique properties that can be explored for various applications.
5. Potential applications
Explanation
Due to its complex structure and reactivity, the compound may have potential applications in industries such as pharmaceuticals, materials science, and organic chemistry.
6. Need for further research
Explanation
To fully understand the properties and potential uses of 1,7-(dioxa)-2,6-diaza-4,7a-dithia-3H,5H-benzo(cd)pentalene-4-oxide, more research and analysis are required.
Check Digit Verification of cas no
The CAS Registry Mumber 85579-26-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,5,7 and 9 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 85579-26:
(7*8)+(6*5)+(5*5)+(4*7)+(3*9)+(2*2)+(1*6)=176
176 % 10 = 6
So 85579-26-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3S2/c8-11-1-3-5-4(2-11)7-10-12(5)9-6-3/h1-2H2
85579-26-6Relevant academic research and scientific papers
The Synthesis and Electrochemical Properties of Some Novel Photosynthesis Electron Acceptors
Camilleri, Patrick,Clark, Michael T.,Gilmore, Ian J.,Cole-Hamilton, David
, p. 833 - 836 (2007/10/02)
A range of dioxathiadiaza heteropentalenes have been prepared and their electrochemical properties have been studied by cyclic voltammetry and e.s.r. spectroscopy.It has been found that these compounds form stable anion radicals in the absence of oxygen and have half-peak reduction potentials in the same range as the bypyridinium compounds such as paraquat (methyl viologen) or diquat.
Electrochemical properties of 1-Oxa-6,6aλ4-dithia-2,5-diazapentalene
Patrick, Camilleri,Gilmore, Ian J.,Cole-Hamilton, David J.
, p. 1797 - 1800 (2007/10/02)
The electrochemical propeties of a number of 1-oxa-6,6aλ4-dithia-2,5-diazapentalenes have been studied by cyclovoltammetry and e.s.r. spectroscopy.In general, these compounds have half-peak reduction potentials in the range -380 to -540 mV (vs.Ag-AgCl).The reduction of these heterapentalenes leads to the formation of stable anion radicals, the e.s.r. spectra of which have been characterised.
