85599-38-8 Usage
General Description
3-(2-amino[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propyl acetate is a chemical compound with a unique structure containing a triazolopyrimidine ring. It is an important intermediate in the synthesis of various pharmaceuticals and agrochemicals. The compound has potential biological activity due to its presence of both an amine group and a triazolopyrimidine ring, which are known for their pharmacophore properties. It also contains a propyl group and an acetate moiety, making it a versatile building block for the development of new drug candidates. Further research and development of this compound could lead to the discovery of novel therapeutics or agrochemicals with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 85599-38-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,5,9 and 9 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 85599-38:
(7*8)+(6*5)+(5*5)+(4*9)+(3*9)+(2*3)+(1*8)=188
188 % 10 = 8
So 85599-38-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N5O2/c1-7(16)17-4-2-3-8-5-12-10-13-9(11)14-15(10)6-8/h5-6H,2-4H2,1H3,(H2,11,14)
