857283-93-3 Usage
Uses
Used in Pharmaceutical Industry:
4-(2-Methyl-1,3-thiazol-4-yl)benzoyl chloride is used as an acylating agent for the synthesis of various organic compounds. Its reactivity and the presence of the thiazole ring make it a valuable component in the development of new pharmaceuticals, contributing to the creation of innovative drug molecules with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(2-Methyl-1,3-thiazol-4-yl)benzoyl chloride serves as a key intermediate in the synthesis of agrochemicals. Its ability to form amides and esters allows for the development of novel compounds with pesticidal properties, enhancing crop protection and contributing to sustainable agriculture.
Used in Specialty Chemicals Production:
4-(2-Methyl-1,3-thiazol-4-yl)benzoyl chloride is also utilized in the production of specialty chemicals. Its unique structure and reactivity enable the synthesis of a wide range of compounds with specific applications in various industries, such as dyes, fragrances, and other high-value chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 857283-93-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 3 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 857283-93:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*3)+(2*9)+(1*3)=213
213 % 10 = 3
So 857283-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H8ClNOS/c1-7-13-10(6-15-7)8-2-4-9(5-3-8)11(12)14/h2-6H,1H3
857283-93-3Relevant academic research and scientific papers
Uncovering an allosteric mode of action for a selective inhibitor of human bloom syndrome protein
Chen, Xiangrong,Ali, Yusuf I.,Fisher, Charlotte EL,Arribas-Bosacoma, Raquel,Rajasekaran, Mohan B.,Williams, Gareth,Walker, Sarah,Booth, Jessica R.,Hudson, Jessica JR,Mark Roe,Pearl, Laurence H.,Ward, Simon E.,Pearl, Frances MG,Oliver, Antony W.
, (2021/04/02)
BLM (Bloom syndrome protein) is a RECQ-family helicase involved in the dissolution of complex DNA structures and repair intermediates. Synthetic lethality analysis implicates BLM as a promising target in a range of cancers with defects in the DNA damage r
