85843-03-4 Usage
Uses
Used in Pharmaceutical Industry:
4-HYDROXY-2,5-DIMETHYL-3-(MORPHOLINOMETHYL)-6-OXO-1,3-CYCLOHEXADIENE-1-CARBONITRILE is used as a building block for the synthesis of pharmaceutical compounds due to its unique structure and potential biological activity. Its presence of a hydroxyl group, two methyl groups, and a morpholinomethyl group allows for versatile chemical modifications, making it a promising candidate for the development of new drugs with therapeutic potential.
Used in Organic Chemistry Research:
4-HYDROXY-2,5-DIMETHYL-3-(MORPHOLINOMETHYL)-6-OXO-1,3-CYCLOHEXADIENE-1-CARBONITRILE is used as a subject of study in organic chemistry research for its unique structure and potential applications. Researchers are investigating its properties, synthesis, and potential uses to better understand its role in the development of new chemical compounds and its implications in various fields, including drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 85843-03-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,8,4 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 85843-03:
(7*8)+(6*5)+(5*8)+(4*4)+(3*3)+(2*0)+(1*3)=154
154 % 10 = 4
So 85843-03-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H17N3O3/c1-9-10(7-14)12(17)15(2)13(18)11(9)8-16-3-5-19-6-4-16/h18H,3-6,8H2,1-2H3
85843-03-4Relevant academic research and scientific papers
Synthesis of Some Mannich Bases of Substituted Glutaconimides as Anticonvulsant Agents
Deval, S. D.,Pednekar, S. R.,Samant, S. D.,Deodhar, K. D.,Nimbkar, A. Y.
, p. 1056 - 1058 (2007/10/02)
Mannich reactions on substituted glutaconimides (I) and (II) furnish the Mannich bases (III-V).All the compounds are found to be devoid of any anticonvulsant activity.
