860003-88-9 Usage
Description
8-BROMO-2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBALDEHYDE is a chemical compound characterized by the presence of a bromine atom and a benzodioxine ring structure. As an aldehyde, it is a carbonyl compound that is widely utilized in organic synthesis and pharmaceutical research. The bromine substitution endows the compound with distinctive reactivity and pharmacological properties, which are beneficial for the development of innovative drugs and chemical processes. Its molecular structure and reactivity position it as a valuable intermediate in the synthesis of a range of organic compounds and pharmaceutical products.
Uses
Used in Pharmaceutical Research:
8-BROMO-2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBALDEHYDE is used as a key intermediate in the synthesis of various pharmaceuticals for its unique reactivity and pharmacological properties. Its bromine atom and benzodioxine ring structure contribute to the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 8-BROMO-2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBALDEHYDE serves as a versatile building block for the creation of complex organic molecules. Its aldehyde group allows for a variety of chemical reactions, facilitating the formation of new compounds with diverse applications.
Used in Chemical Process Development:
8-BROMO-2,3-DIHYDRO-1,4-BENZODIOXINE-6-CARBALDEHYDE is employed as a reactant in the development of novel chemical processes. Its unique reactivity and properties can be harnessed to improve existing processes or to create new ones, potentially leading to more efficient and sustainable chemical production methods.
Check Digit Verification of cas no
The CAS Registry Mumber 860003-88-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,0,0,0 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 860003-88:
(8*8)+(7*6)+(6*0)+(5*0)+(4*0)+(3*3)+(2*8)+(1*8)=139
139 % 10 = 9
So 860003-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H7BrO3/c10-7-3-6(5-11)4-8-9(7)13-2-1-12-8/h3-5H,1-2H2
860003-88-9Relevant articles and documents
TRYCLIC NITROGEN CONTAINING COMPOUNDS AND THEIR USE AS ANTIBACTERIALS
-
Page/Page column 45, (2008/06/13)
Tricyclic nitrogen containing compounds of formula (I) and their use as antibacterials.
ANTIBACTERIAL AGENTS
-
Page/Page column 88, (2010/02/15)
Naphthalene, quinoline, quinoxaline and naphthyridine derivatives useful in the treatment of bacterial infections in mammals, particularly humans, are disclosed herein.
Diaminopyrimidines as P2X3 and P2X2/3 antagonists
-
Page/Page column 112, (2010/02/14)
Compounds and methods for treating diseases mediated by a P2X3 and/or a P2X2/3 receptor antagonist, the methods comprising administering to a subject in need thereof an effective amount of a compound of formula (I): or a pharmaceutically acceptable salt, solvate or prodrug thereof, wherein D, X, Y, R1, R2, R3, R4, R5, R6, R7 and R8 are as defined herein.
