861340-10-5 Usage
Uses
Used in Pharmaceutical Industry:
1H-Indazole-4-carbonitrile is used as a key intermediate for the synthesis of various pharmaceuticals due to its ability to contribute to the development of new drugs with potential therapeutic applications. Its unique chemical structure allows for the creation of molecules with specific biological activities, enhancing the range of treatments available for various medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 1H-Indazole-4-carbonitrile is utilized as a building block in the synthesis of agrochemicals, contributing to the development of new pesticides, herbicides, and other crop protection agents. Its chemical properties enable the design of compounds that can effectively target and control pests and diseases, thereby improving crop yields and food security.
Used in Medicinal Chemistry Research:
1H-Indazole-4-carbonitrile serves as a valuable tool in medicinal chemistry research, where it is employed in the design and synthesis of novel compounds with potential therapeutic properties. Its versatility allows researchers to explore a wide range of chemical modifications, facilitating the discovery of new drugs and advancing the field of medicinal chemistry.
Used in Material Science:
In the realm of material science, 1H-Indazole-4-carbonitrile is used for the development of new materials with specific properties. Its unique structure and reactivity can be leveraged to create materials with applications in various industries, such as electronics, coatings, and advanced materials for specialized uses.
Overall, 1H-Indazole-4-carbonitrile's diverse applications across different industries highlight its importance as a versatile chemical intermediate, contributing to advancements in healthcare, agriculture, and material technology.
Check Digit Verification of cas no
The CAS Registry Mumber 861340-10-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,1,3,4 and 0 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 861340-10:
(8*8)+(7*6)+(6*1)+(5*3)+(4*4)+(3*0)+(2*1)+(1*0)=145
145 % 10 = 5
So 861340-10-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H5N3/c9-4-6-2-1-3-8-7(6)5-10-11-8/h1-3,5H,(H,10,11)
861340-10-5Relevant articles and documents
OXADIAZOLE DERIVATIVES AND PHARMACEUTICAL USES THEREOF
-
Paragraph 0286-0287, (2017/02/02)
PROBLEM TO BE SOLVED: To provide therapeutic or preventive agents for various diseases or symptoms associated with a serotonin 4 receptor (particularly, neuropsychiatric diseases such as Alzheimer-type dementia). SOLUTION: The present invention provides a compound represented by formula (1) or a pharmaceutically acceptable salt thereof. In the formula (1), Het represents formula (Het-1) or the like, A represents formula (A-1) or the like, B represents (B-1) or the like, R1A represents a hydrogen atom, an alkyl group or the like, R2A, R5, R6 and R7 represent a hydrogen atom, a halogen atom, an alkyl group or the like, R8 and R9 represent a hydrogen atom, an alkyl group or the like, and l represents an integer of 0-4. SELECTED DRAWING: None COPYRIGHT: (C)2016,JPOandINPIT
SERINE/THREONINE PAK1 INHIBITORS
-
Page/Page column 111, (2013/03/26)
Compounds having the formula I wherein A, Z, R1a, R1b, R2, R3, R4, R5, R6, R7, R9, R10, Ra, Rb and n are as defined herein are inhibitors of PAK1. Also disclosed are compositions and methods for treating cancer and hyperproliferative disorders.
3-AMINO-1-ARYLPROPYL INDOLES AS MONOAMINE REUPTAKE INHIBITOR
-
Page/Page column 102-103, (2010/02/15)
Compounds of formula I: or pharmaceutically acceptable salts thereof, wherein p, Ar, R1, R2, R3, Ra, Rb, Rc, Rd and Re are defined herein, pharmaceutical compositions containing them and methods of using them for the preparation of medicaments for treating depression or anxiety.
