861872-50-6 Usage
Uses
Used in Pharmaceutical Industry:
7-Bromo-3-phenyl-2-quinolinol is used as a building block for the synthesis of new drugs due to its unique structure and properties. It can contribute to the development of pharmaceuticals with novel therapeutic effects and improved pharmacological profiles.
Used in Agrochemical Industry:
In the agrochemical field, 7-Bromo-3-phenyl-2-quinolinol is utilized as a precursor for the synthesis of new pesticides. Its chemical properties allow for the creation of pesticides with enhanced efficacy and selectivity, potentially leading to more sustainable agricultural practices.
Used in Materials Science:
7-Bromo-3-phenyl-2-quinolinol is employed as a component in the development of functional materials. Its incorporation can lead to materials with improved properties, such as enhanced stability, reactivity, or specific interactions, which can be applied in various technological and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 861872-50-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,1,8,7 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 861872-50:
(8*8)+(7*6)+(6*1)+(5*8)+(4*7)+(3*2)+(2*5)+(1*0)=196
196 % 10 = 6
So 861872-50-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H10BrNO/c16-12-7-6-11-8-13(10-4-2-1-3-5-10)15(18)17-14(11)9-12/h1-9H,(H,17,18)
861872-50-6Relevant academic research and scientific papers
QUINOLINE DERIVATIVES AND USE THEREOF AS MYCOBACTERIAL INHIBITORS
-
Page/Page column 35, (2008/06/13)
The present invention relates to novel substituted quinoline derivatives according to the general Formula (Ia) or the general Formula (Ib) the pharmaceutically acceptable acid or base addition salts thereof, the quaternary amines thereof, the stereochemic
