863377-22-4 Usage
Uses
Used in Organic Synthesis:
3-(Morpholino)phenylboronic acid is utilized as a reagent in Suzuki-Miyaura cross-coupling reactions, which are crucial for the formation of carbon-carbon bonds. Its role in these reactions is to facilitate the formation of new chemical entities, contributing to the synthesis of complex organic molecules.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3-(Morpholino)phenylboronic acid is studied for its potential as a therapeutic agent, particularly in the treatment of cancer and other diseases. Its unique chemical structure allows it to interact with biological targets, offering a promising avenue for the development of new drugs.
Used in Analytical Chemistry:
3-(Morpholino)phenylboronic acid has demonstrated its effectiveness in the development of fluorescent sensors for detecting carbohydrates and other biomolecules. Its ability to selectively bind to these targets makes it a valuable tool in analytical chemistry for the detection and quantification of specific biomolecules in complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 863377-22-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,6,3,3,7 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 863377-22:
(8*8)+(7*6)+(6*3)+(5*3)+(4*7)+(3*7)+(2*2)+(1*2)=194
194 % 10 = 4
So 863377-22-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO3/c13-11(14)9-2-1-3-10(8-9)12-4-6-15-7-5-12/h1-3,8,13-14H,4-7H2
