874509-45-2

Usage

Uses

Used in Pharmaceutical Industry:
5-BROMO-4-METHYL-2-THIAZOLECARBOXYLIC ACID is used as a building block for the synthesis of various drugs due to its antimicrobial and antifungal properties. It plays a crucial role in the development of new pharmaceuticals targeting a wide range of infections and diseases.
Used in Agricultural Industry:
In the agricultural sector, 5-BROMO-4-METHYL-2-THIAZOLECARBOXYLIC ACID is utilized as a precursor for the synthesis of pesticides. Its antimicrobial and antifungal properties contribute to the creation of effective crop protection agents, ensuring higher yields and better crop quality.
Used in Material Science:
5-BROMO-4-METHYL-2-THIAZOLECARBOXYLIC ACID has potential applications in the field of material science. It is used for the synthesis of functionalized polymers and materials, where its unique chemical structure can impart specific properties to the resulting materials, such as enhanced stability, reactivity, or selectivity in various applications.

InChI:InChI=1/C5H4BrNO2S/c1-2-3(6)10-4(7-2)5(8)9/h1H3,(H,8,9)

Upstream product

• 859481-85-9 5-bromo-4-methyl-thiazole-2-carbonitrile 
• 859480-77-6 5-bromo-4-methyl-thiazole-2-carboxylic acid amide 
• 79247-78-2 2,5-dibromo-4-methylthiazole 
• 124-38-9 carbon dioxide 

Downstream Products

• 79247-79-3 methyl 5-bromo-4-methylthiazole-2-carboxylate 

Relevant academic research and scientific papers

Viral polymerase inhibitors

An isomer, enantiomer, diastereoisomer, or tautomer of a compound, represented by formula I: wherein R1 is selected from: H, haloalkyl, (C1-6)alkyl, (C2-6)alkenyl, (C3-7)cycloalkyl, (C2-6)alkynyl, (C5-7)cycloalkenyl, 6 or 10-membered aryl, Het all optionally substituted; R2 is selected from (C1-6)alkyl, (C3-7)cycloalkyl, (C6-10)bicycloalkyl, 6- or 10-membered aryl, or Het all optionally substituted; B is N or CR5, wherein R5 is H, halogen, haloalkyl, (C1-6)alkyl, (C3-7)cycloalkyl or (C1-6)alkyl-(C3-7)cycloalkyl; X is N or CR5; D is N or CR5; each of Y1 and Y2 is independently O or S; Z is O, N, or NRz wherein Rz is H, (C1-6)alkyl, (C3-7)cycloalkyl or (C1-6)alkyl-(C3-7)cycloalkyl; R3 and R4 are each independently H, (C1-6)alkyl, first (C3-7)cycloalkyl or 6- or 10-membered aryl, Het (C1-6)alkyl-6- or 10-membered aryl, (C1-6)alkyl-Het; or each R3 and R4 are independently covalently bonded together to form second (C3-7)cycloalkyl, or heterocycle, all optionally substituted; or when Z is N, either R3 or R4 are independently covalently bonded thereto to form a nitrogen-containing heterocycle; R7 is H, (C1-6 alkyl), (C3-7)cycloalkyl or (C1-6)alkyl-(C3-7)cycloalkyl; or R7 is covalently bonded to either of R3 or R4 to form a heterocycle; A is (C1-6) alkyl-CONHR8 wherein R8 is-6- or 10-membered aryl, or Het; or A is a 6- or 10-membered aryl, or Het said aryl or Het being optionally substituted; or a salt or a derivative thereof; such compounds being potent inhibitors of HCV NS5B polymerase.