87751-73-3 Usage
Uses
Used in Pharmaceutical Industry:
(2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid is used as a pharmaceutical compound for its potential therapeutic properties. Its unique structure with phenyl, acrylic acid, hydroxyphenyl, and ethoxy groups may contribute to its activity against certain diseases or conditions, making it a candidate for drug development.
Used in Organic Synthesis:
In the field of organic synthesis, (2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid serves as a key intermediate or building block for the synthesis of more complex organic molecules. Its functional groups can be utilized in various chemical reactions to form a wide range of compounds with diverse applications.
Used in Research:
(2Z)-3-(3-Ethoxy-4-hydroxyphenyl)-2-phenylacrylic acid is also used in research settings to study its chemical properties, reactivity, and potential interactions with other molecules. This can lead to a better understanding of its behavior and possible applications in various chemical and biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 87751-73-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,7,7,5 and 1 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 87751-73:
(7*8)+(6*7)+(5*7)+(4*5)+(3*1)+(2*7)+(1*3)=173
173 % 10 = 3
So 87751-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H16O4/c1-2-21-16-11-12(8-9-15(16)18)10-14(17(19)20)13-6-4-3-5-7-13/h3-11,18H,2H2,1H3,(H,19,20)/p-1/b14-10-
87751-73-3Relevant academic research and scientific papers
Antioxidant, anti-tyrosinase and anti-melanogenic effects of (E)-2,3-diphenylacrylic acid derivatives
Ullah, Sultan,Park, Yujin,Park, Chaeun,Lee, Sanggwon,Kang, Dongwan,Yang, Jungho,Akter, Jinia,Chun, Pusoon,Moon, Hyung Ryong
, p. 2192 - 2200 (2019/04/30)
During our continued search for strong skin whitening agents over the past ten years, we have investigated the efficacies of many tyrosinase inhibitors containing a common (E)-β-phenyl-α,β-unsaturated carbonyl scaffold, which we found to be essential for