88075-70-1 Usage
Uses
Used in Pharmaceutical Industry:
2,4-DIAMINO-6-HYDROXY-PYRIMIDINE-5-CARBALDEHYDE serves as a crucial building block for the synthesis of an array of drugs and bioactive molecules. Its incorporation into these compounds enhances their therapeutic potential and contributes to the development of novel treatments for various medical conditions.
Used in Materials Development:
In the realm of materials science, 2,4-DIAMINO-6-HYDROXY-PYRIMIDINE-5-CARBALDEHYDE is utilized in the creation of innovative materials. Its chemical properties allow for the engineering of substances with unique characteristics that can be applied across different industries.
Used in Chemical Processes:
2,4-DIAMINO-6-HYDROXY-PYRIMIDINE-5-CARBALDEHYDE also plays a significant role in various chemical processes, where it acts as an intermediate. Its reactivity and functional groups enable the production of a diverse range of compounds, each with specific applications and potential uses in both biological and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 88075-70-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,0,7 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 88075-70:
(7*8)+(6*8)+(5*0)+(4*7)+(3*5)+(2*7)+(1*0)=161
161 % 10 = 1
So 88075-70-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N4O2/c6-3-2(1-10)4(11)9-5(7)8-3/h1H,(H5,6,7,8,9,11)
88075-70-1Relevant academic research and scientific papers
SYNTHESIS OF 5-FORMYL-2,4,6-TRISUBSTITUTED PYRIMIDINES
Delia, Thomas J.,Otteman, Ronald
, p. 1805 - 1809 (2007/10/02)
A facile synthesis of 5-formyl-2,4,6-trisubstituted pyrimidines bearing amino and hydroxy groups is described.The Vilsmeier reagent, under mild conditions, gives good yields of products without accompanying chlorination of hydroxy groups.
