882980-86-1 Usage
Explanation
The IUPAC name is a standardized nomenclature system used to name chemical compounds. It provides information about the structure and arrangement of atoms in the molecule.
Explanation
The compound is an ethyl ester derivative of the (2S)-1,4-benzodioxin-2-carboxylic acid, 2,3-dihydro-. An ester is formed when an alcohol (in this case, ethanol) reacts with a carboxylic acid.
4. Benzodioxin Derivative
Explanation
The compound is derived from benzodioxin, which is a fused-ring system consisting of a benzene ring and a dioxin ring. The presence of the dioxin ring gives the compound unique properties.
Explanation
The (2S)notation indicates that the compound has a chiral center at the 2nd carbon atom, which means it has a non-superimposable mirror image (enantiomer). The (2S)designation specifies the configuration of the chiral center as being on the left side when viewed from the priority direction.
Explanation
The compound may have potential applications in the pharmaceutical industry, particularly in the development of new drugs. This is due to its unique structure and properties, which could be exploited for various therapeutic purposes.
Explanation
The specific properties and uses of 1,4-Benzodioxin-2-carboxylic acid, 2,3-dihydro-, ethyl ester, (2S)would depend on further research and testing. This includes understanding its chemical reactivity, stability, and potential interactions with biological systems.
Explanation
The compound's structure consists of a benzene ring fused with a dioxin ring, which contributes to its unique chemical properties and potential applications.
Explanation
The compound contains a carboxylic acid group (-COOH), an ester group (-COOEt), and an ethyl group (-CH2CH3). These functional groups play a crucial role in determining the compound's reactivity and potential applications.
Explanation
The presence of a chiral center at the 2nd carbon atom in the compound results in the formation of enantiomers, which can have different biological activities and properties. This stereochemistry is important for understanding the compound's potential applications and effects.
Ethyl Ester Form
(2S)-1,4-Benzodioxin-2-carboxylic acid, 2,3-dihydro-
Chirality
(2S)-
Potential Applications
Pharmaceutical Industry
Further Research and Testing
Required
Structure
Fused-ring system with a benzene ring and a dioxin ring
Functional Groups
Carboxylic Acid, Ester, and Ethyl Group
Stereochemistry
Chiral center at the 2nd carbon atom
Check Digit Verification of cas no
The CAS Registry Mumber 882980-86-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,2,9,8 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 882980-86:
(8*8)+(7*8)+(6*2)+(5*9)+(4*8)+(3*0)+(2*8)+(1*6)=231
231 % 10 = 1
So 882980-86-1 is a valid CAS Registry Number.
InChI:InChI=1S/C11H12O4/c1-2-13-11(12)10-7-14-8-5-3-4-6-9(8)15-10/h3-6,10H,2,7H2,1H3/t10-/m0/s1
882980-86-1Relevant academic research and scientific papers
Chemoenzymatic synthesis of piperoxan, prosympal, dibozane, and doxazosin
Rouf, Abdul,Gupta, Pankaj,Aga, Mushtaq A.,Kumar, Brijesh,Chaubey, Asha,Parshad, Rajinder,Taneja, Subhash C.
, p. 1615 - 1623 (2013/02/22)
The synthesis of both enantiomers of 1,4-benzodioxan-2-carboxylic acid 1, a key synthetic intermediate for the therapeutic agents piperoxan, prosympal, dibozane, and doxazosin was achieved with good yields and high enantioselectivities via the Arthrobacter sp. lipase catalyzed kinetic resolution of ester (±)-17a. The influence of the co-solvents and the immobilization of the lipase upon kinetic resolution demonstrated that immobilized whole cells, in the presence of n-butanol as a co-solvent, resulted in the optimal resolution of the substrate (ee ～99%, E = 535) at 258 mmol (50 g/L) substrate concentration.
