884494-35-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-5-fluoro-3-hydroxypyridine is used as an intermediate in the synthesis of various pharmaceuticals for its unique structural properties. Its presence in the molecular structure can contribute to the development of new drugs with specific therapeutic effects.
Used in Agrochemical Industry:
In the agrochemical industry, 2-chloro-5-fluoro-3-hydroxypyridine is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its unique chemical structure allows for the creation of compounds with targeted effects on pests and weeds, enhancing crop protection.
Used in Organic Chemistry:
2-Chloro-5-fluoro-3-hydroxypyridine serves as a building block in organic chemistry, enabling the synthesis of a wide range of organic compounds. Its presence in these compounds can impart specific chemical properties, making it a valuable component in the development of new organic materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-35-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 884494-35:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*3)+(1*5)=223
223 % 10 = 3
So 884494-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C5H3ClFNO/c6-5-4(9)1-3(7)2-8-5/h1-2,9H
884494-35-3Relevant academic research and scientific papers
Polycyclic compound and application thereof as antiviral drug
-
Paragraph 0177; 0179; 0180; 0181, (2021/04/03)
The invention relates to a polycyclic compound and application of the polycyclic compound as an antiviral drug, in particular to a compound shown in a formula (I) or pharmaceutically acceptable salts,solvates, geometric isomers, stereoisomers, tautomers and any mixtures thereof. The compound shown in the formula (I) or the pharmaceutically acceptable salts, solvates and medicinal compositions thereof can be used for treating and/or preventing hepatitis B virus infection, and particularly, the compound, a TLR7 inhibitor and nucleoside medicines can be used as medicinal compositions for curinghepatitis B.
