884494-37-5 Usage
General Description
2-Bromo-3-fluoro-4-picoline is a chemical compound with the molecular formula C6H4BrFN. It is a heterocyclic aromatic compound containing a pyridine ring with a bromine atom substitution at the 2-position, a fluorine atom substitution at the 3-position, and a methyl group at the 4-position. 2-BROMO-3-FLUORO-4-PICOLINE is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is also used in research and development as a building block for creating new chemical compounds with specific properties and applications. Additionally, 2-Bromo-3-fluoro-4-picoline is known for its potential use as a ligand in organometallic chemistry and catalysis.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 884494-37:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*3)+(1*7)=225
225 % 10 = 5
So 884494-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BrFN/c1-4-2-3-9-6(7)5(4)8/h2-3H,1H3
