885267-36-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3-Fluoro-6-bromo-2-pyridinecarboxaldehyde is utilized as a key intermediate in the synthesis of pharmaceuticals. Its distinctive structure allows for the development of new drugs with potential therapeutic properties, contributing to advancements in medicinal chemistry.
Used in Agrochemical Production:
In the agrochemical industry, 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde serves as a crucial building block for the creation of novel agrochemicals. Its incorporation into these compounds can lead to the development of more effective and targeted pest control solutions.
Used in Fine Chemicals Synthesis:
3-Fluoro-6-bromo-2-pyridinecarboxaldehyde is employed as a versatile intermediate in the synthesis of fine chemicals. Its unique reactivity and structural features enable the production of high-quality specialty chemicals for various applications.
Used in Materials Science:
3-Fluoro-6-bromo-2-pyridinecarboxaldehyde has potential applications in the field of materials science, particularly in the development of new functional materials. Its unique properties can be harnessed to create innovative materials with enhanced performance characteristics.
Due to its significance in drug discovery and chemical research, 3-Fluoro-6-bromo-2-pyridinecarboxaldehyde is a well-studied and widely utilized chemical compound, playing a crucial role in the advancement of various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 885267-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,6 and 7 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 885267-36:
(8*8)+(7*8)+(6*5)+(5*2)+(4*6)+(3*7)+(2*3)+(1*6)=217
217 % 10 = 7
So 885267-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrFNO/c7-6-2-1-4(8)5(3-10)9-6/h1-3H
885267-36-7Relevant academic research and scientific papers
COMPOUNDS AND COMPOSITIONS FOR USE IN TREATING SKIN DISORDERS
-
Paragraph 1526-1528, (2021/08/06)
Provided herein is a compound of formula (XXXII) or a pharmaceutically acceptable salt, solvate, hydrate, stereoisomer thereof or a physiologically functional derivative thereof, wherein R1, R2, R3, G, A, E, n, p, and q are defined herein. Also provided herein are compositions comprising a compound of formula (XXXII), and methods of using a compound of formula (XXXII), e.g., in the treatment or prevention of skin disorders.
BIARYL KINASE INHIBITORS
-
Page/Page column 328; 329, (2017/05/07)
The present disclosure is directed to biaryl compounds of formula (I) which can inhibit AAKl (adaptor associated kinase 1), compositions comprising such compounds and their use for treating e.g. pain, Alzheimer's disease, Parkinson's disease and schizophrenia.
