885273-52-9 Usage
Uses
Used in Organic Synthesis:
3-(3-Fluoro-phenyl)-isoxazole-5-carbaldehyde is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block for the development of new molecules with potential applications in different industries.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 3-(3-Fluoro-phenyl)-isoxazole-5-carbaldehyde is used as a starting material for the design and synthesis of novel drug candidates. Its structural features can be exploited to create molecules with specific biological activities, potentially leading to the discovery of new therapeutic agents.
Used in Materials Science:
3-(3-Fluoro-phenyl)-isoxazole-5-carbaldehyde can be utilized in the development of advanced materials with unique properties. Its incorporation into polymers, for example, may result in materials with improved thermal stability, mechanical strength, or other desirable characteristics for use in various applications.
Used in Chemical Research:
3-(3-Fluoro-phenyl)-isoxazole-5-carbaldehyde serves as a valuable research tool in the field of chemistry. Its synthesis and reactivity can provide insights into the behavior of isoxazole-containing compounds, contributing to the understanding of their properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 885273-52-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 3 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 885273-52:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*3)+(2*5)+(1*2)=209
209 % 10 = 9
So 885273-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H6FNO2/c11-8-3-1-2-7(4-8)10-5-9(6-13)14-12-10/h1-6H
