885519-08-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-5-fluoro (1H)indazole is used as a key intermediate in the synthesis of potential drug candidates, contributing to the development of new therapeutic agents. Its unique structure allows for the creation of pharmaceutical intermediates that can be further modified to achieve desired medicinal properties.
Used in Organic Chemistry:
3-Bromo-5-fluoro (1H)indazole serves as a valuable building block in the synthesis of various functionalized molecules. Its presence in these molecules can impart specific chemical reactivity or properties, making it an essential component in the creation of complex organic compounds.
Used in Biological Research:
3-Bromo-5-fluoro (1H)indazole is used as a subject of study for its potential biological activities, such as anti-cancer and anti-inflammatory properties. This research can lead to a better understanding of its effects on biological systems and potentially pave the way for its use in therapeutic applications.
Overall, 3-Bromo-5-fluoro (1H)indazole is a versatile chemical compound with a wide range of potential applications in pharmaceuticals, organic chemistry, and biological research.
Check Digit Verification of cas no
The CAS Registry Mumber 885519-08-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,5,1 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 885519-08:
(8*8)+(7*8)+(6*5)+(5*5)+(4*1)+(3*9)+(2*0)+(1*8)=214
214 % 10 = 4
So 885519-08-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrFN2/c8-7-5-3-4(9)1-2-6(5)10-11-7/h1-3H,(H,10,11)
885519-08-4Relevant academic research and scientific papers
SUBSTITUTED INDAZOLE COMPOUNDS AS IRAK4 INHIBITORS
-
, (2016/04/26)
The present invention provides substituted indazole compound of formula (I) and pharmaceutically acceptable salts thereof, and their use to inhibit IRAK4 and/or for the treatment of diseases or disorders induced by IRAK4.
