88569-83-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Methoxy-6-(methylamino)pyridine is used as a building block for the synthesis of pharmaceuticals, contributing to the development of new drugs. Its unique structure allows for the creation of diverse medicinal compounds with potential therapeutic applications.
Used in Agrochemical Production:
In the agrochemical industry, 2-Methoxy-6-(methylamino)pyridine is utilized as a building block for the synthesis of various agrochemicals. Its incorporation into these products can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Dye Manufacturing:
2-Methoxy-6-(methylamino)pyridine is employed as a building block in the production of dyes. Its chemical properties enable the creation of a wide range of dyes with different color characteristics, suitable for various industries, including textiles, plastics, and printing.
Used as a Reagent in Organic Synthesis:
2-Methoxy-6-(methylamino)pyridine serves as a reagent in organic synthesis, facilitating various chemical reactions. Its reactivity allows for the formation of new compounds and contributes to the advancement of organic chemistry.
Used as a Ligand in Coordination Chemistry:
In coordination chemistry, 2-Methoxy-6-(methylamino)pyridine is used as a ligand. Its ability to form coordination complexes with metal ions is valuable for the study and development of new materials with specific properties and applications.
Used in Medicinal Chemistry and Drug Discovery:
Due to its unique chemical structure and reactivity, 2-Methoxy-6-(methylamino)pyridine has potential applications in the field of medicinal chemistry and drug discovery. It can be used to design and synthesize new compounds with therapeutic potential, contributing to the development of innovative treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 88569-83-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,5,6 and 9 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 88569-83:
(7*8)+(6*8)+(5*5)+(4*6)+(3*9)+(2*8)+(1*3)=199
199 % 10 = 9
So 88569-83-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O.ClH/c1-8-6-4-3-5-7(9-6)10-2;/h3-5H,1-2H3,(H,8,9);1H
88569-83-9Relevant academic research and scientific papers
BICYCLIC PYRIDONE LACTAMS AND METHODS OF USE THEREOF
-
Page/Page column 49, (2018/05/15)
The invention provides novel compounds having the general formula (I) wherein R1, X, Zlto Z5, L, n, the A ring, and the B ring, are as described herein, pharmaceutical compositions including the compounds and methods of using the compounds.Compounds (I) act as inhibitors of RIP1 kinase.
2-Alkylaminopyridine derivatives
-
, (2008/06/13)
2-Alkylaminopyridine derivatives represented by a general formula of STR1 wherein R denotes a lower alkyl group and Y denotes a methoxy group or a halogen atom, and method for producing the same.
