88780-84-1 Usage
Uses
Used in Pharmaceutical Industry:
3H-1,2,3-Triazolo[4,5-d]pyriMidin-5-aMine, 7-chlorois used as a potential therapeutic agent for various medical conditions due to its unique molecular structure and pharmacological properties. Its ability to interact with specific biological targets and modulate cellular processes makes it a valuable candidate for the development of new drugs and treatments.
Used in Research and Development:
3H-1,2,3-Triazolo[4,5-d]pyriMidin-5-aMine, 7-chlorois utilized in research and development for the discovery of new pharmaceutical compounds. Its unique molecular properties and potential pharmacological activities provide a foundation for exploring its efficacy and safety in treating various diseases and conditions. Further studies are needed to understand its mechanism of action, optimize its therapeutic potential, and evaluate its suitability for clinical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 88780-84-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,7,8 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 88780-84:
(7*8)+(6*8)+(5*7)+(4*8)+(3*0)+(2*8)+(1*4)=191
191 % 10 = 1
So 88780-84-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H5ClN6/c5-2-1-3(10-11-9-1)8-4(6)7-2/h9,11H,(H3,6,7,8,10)