888070-04-0 Usage
Uses
Used in Pharmaceutical Synthesis:
(2-Piperidinopyrid-4-yl)methanol is used as a precursor for the synthesis of various drugs and other bioactive compounds due to its structural features. Its unique molecular structure allows it to be a versatile component in the development of new medications.
Used in Medicinal Chemistry:
(2-Piperidinopyrid-4-yl)methanol is utilized in medicinal chemistry for its potential applications in drug development. Its biological activity and ability to be modified for specific therapeutic purposes make it a valuable compound in the field of medicinal chemistry.
Used in Drug Development:
(2-Piperidinopyrid-4-yl)methanol is used in drug development to create new pharmaceuticals with potential therapeutic benefits. Its presence in various studies showcasing its biological activity highlights its potential as a key component in the development of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 888070-04-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,8,0,7 and 0 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 888070-04:
(8*8)+(7*8)+(6*8)+(5*0)+(4*7)+(3*0)+(2*0)+(1*4)=200
200 % 10 = 0
So 888070-04-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O/c14-9-10-4-5-12-11(8-10)13-6-2-1-3-7-13/h4-5,8,14H,1-3,6-7,9H2
888070-04-0Relevant articles and documents
Benzothiazole Formulations and Use Thereof
-
, (2010/11/30)
The present invention is related to macrogol glyceride pharmaceutical formulations containing benzothiazole derivatives. In particular, the invention is related to benzothiazole stearoyl macrogol pharmaceutical formulations, method of preparation and use thereof.
