89283-92-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Amino-5-bromo-4-chloropyridine is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure and functional groups enable the development of new drugs with specific therapeutic properties, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Amino-5-bromo-4-chloropyridine serves as an essential intermediate for the production of agrochemicals, such as pesticides and herbicides. Its versatile reactivity allows for the creation of effective compounds that protect crops and enhance agricultural productivity.
Used in Fine Chemicals Industry:
3-Amino-5-bromo-4-chloropyridine is utilized as a building block in the synthesis of fine chemicals, which are high-purity chemicals used in various applications, including fragrances, dyes, and specialty chemicals. Its unique properties and reactivity contribute to the development of high-quality and innovative fine chemicals.
Used in Research and Development:
As a versatile reagent in organic chemistry, 3-Amino-5-bromo-4-chloropyridine is extensively used in research and development for exploring new chemical reactions, synthesis pathways, and the discovery of novel compounds with potential applications in various industries.
Used in Chemical Synthesis:
3-Amino-5-bromo-4-chloropyridine plays a crucial role in chemical synthesis, where it is employed as a starting material or intermediate in the preparation of a wide range of organic compounds. Its ability to participate in various chemical reactions, such as nucleophilic substitution, electrophilic substitution, and reductive amination, makes it an indispensable compound in the field of chemical synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 89283-92-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,2,8 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 89283-92:
(7*8)+(6*9)+(5*2)+(4*8)+(3*3)+(2*9)+(1*2)=181
181 % 10 = 1
So 89283-92-1 is a valid CAS Registry Number.
InChI:InChI=1S/C5H4BrClN2/c6-3-1-9-2-4(8)5(3)7/h1-2H,8H2
89283-92-1Relevant academic research and scientific papers
THIAZOLOPYRIDINE DERIVATIVES AS ADENOSINE RECEPTOR ANTAGONISTS
-
Page/Page column 142, (2019/02/15)
The invention relates to thiazolopyridine derivatives of the general formula I, and the use of the compounds of the present invention for the treatment and/or prevention of hyperproliferative or infectious diseases and disorders in mammals, especially humans, and pharmaceutical compositions containing such compound.
Derivatives of sulfur-containing heterocyclic carboxylic acids and preparation method and application thereof
-
Paragraph 0475; 0477; 0478, (2017/06/21)
The invention belongs to the field of medicines and particularly relates to derivatives of a series of sulfur-containing heterocyclic carboxylic acids, officinal salts thereof, a preparation method of pharmaceutically acceptable prodrugs, drug compositions including derivatives and application of the derivatives and the drug compositions in preparation of anti-gout drugs and treatment of related diseases.
