89532-09-2 Usage
General Description
Levulinic acid semicarbazone is a chemical compound that is derived from levulinic acid, which is a key platform chemical that can be produced from renewable resources such as biomass. Levulinic acid semicarbazone has been studied for its potential applications as a chelating agent for various metal ions, as well as for its antibacterial and antifungal properties. It has also been investigated for its potential use as a corrosion inhibitor in various industrial processes. Additionally, levulinic acid semicarbazone has been studied for its potential as a precursor for the synthesis of other organic compounds, making it an important chemical for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 89532-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,3 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 89532-09:
(7*8)+(6*9)+(5*5)+(4*3)+(3*2)+(2*0)+(1*9)=162
162 % 10 = 2
So 89532-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3O3/c1-4(2-3-5(10)11)8-9-6(7)12/h2-3H2,1H3,(H,10,11)(H3,7,9,12)
