89532-09-2 Usage
Uses
Used in Chelating Applications:
Levulinic acid semicarbazone is used as a chelating agent for various metal ions, which can help in the separation and purification of metal ions in industrial processes.
Used in Antibacterial Applications:
Levulinic acid semicarbazone is used as an antibacterial agent, which can help in controlling bacterial growth and preventing infections in various applications.
Used in Antifungal Applications:
Levulinic acid semicarbazone is used as an antifungal agent, which can help in controlling fungal growth and preventing fungal infections in various applications.
Used in Corrosion Inhibition:
Levulinic acid semicarbazone is used as a corrosion inhibitor in various industrial processes, which can help in preventing the corrosion of metal surfaces and extending the life of equipment.
Used in Organic Synthesis:
Levulinic acid semicarbazone is used as a precursor for the synthesis of other organic compounds, which can be used in various industrial applications such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 89532-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,3 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 89532-09:
(7*8)+(6*9)+(5*5)+(4*3)+(3*2)+(2*0)+(1*9)=162
162 % 10 = 2
So 89532-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H11N3O3/c1-4(2-3-5(10)11)8-9-6(7)12/h2-3H2,1H3,(H,10,11)(H3,7,9,12)
