89557-35-7 Usage
Uses
Used in Pharmaceutical Industry:
4-N-PROPYLBENZALDEHYDE DIETHYL ACETAL is used as a reagent for the synthesis of (E)-Dihydro-1H-pyrazoles, which are important heterocyclic compounds with potential applications in the development of pharmaceuticals. The synthesis involves a tandem intermolecular addition-cyclization of N-?Propargylic Sulfonylhydrazones, a process that highlights the compound's utility in creating complex molecular structures.
Used in Chemical Research:
In the field of chemical research, 4-N-PROPYLBENZALDEHYDE DIETHYL ACETAL is employed as a key intermediate for the preparation of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable tool for exploring new chemical reactions and developing novel compounds with potential applications in various industries.
Used in Flavor and Fragrance Industry:
Due to its aromatic nature, 4-N-PROPYLBENZALDEHYDE DIETHYL ACETAL can also be used as a building block in the synthesis of fragrances and flavor compounds. Its ability to contribute to the overall scent profile of a product makes it a valuable component in the creation of unique and appealing fragrances and flavors for various consumer products.
Check Digit Verification of cas no
The CAS Registry Mumber 89557-35-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,5 and 7 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 89557-35:
(7*8)+(6*9)+(5*5)+(4*5)+(3*7)+(2*3)+(1*5)=187
187 % 10 = 7
So 89557-35-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H22O2/c1-4-7-12-8-10-13(11-9-12)14(15-5-2)16-6-3/h8-11,14H,4-7H2,1-3H3
