89598-97-0 Usage
Uses
Used in Organic Synthesis:
(5-BROMO-2-HYDROXY)BENZENEBORONIC ACID is used as a building block in the synthesis of various pharmaceuticals and agrochemicals, contributing to the development of new and improved chemical compounds for medical and agricultural applications.
Used as a Catalyst in Chemical Reactions:
(5-BROMO-2-HYDROXY)BENZENEBORONIC ACID serves as a catalyst for a range of chemical reactions, including the Suzuki-Miyaura cross-coupling reactions. This role enhances the efficiency and selectivity of these reactions, facilitating the formation of desired products and reducing the need for harsh conditions or additional reagents.
Used in Materials Science:
(5-BROMO-2-HYDROXY)BENZENEBORONIC ACID has potential applications in the field of materials science, where its unique properties can be harnessed to create new materials with specific characteristics, such as improved mechanical strength, thermal stability, or electrical conductivity.
Used in Medicinal Chemistry:
Due to its versatile reactivity and ability to form strong bonds with other molecules, (5-BROMO-2-HYDROXY)BENZENEBORONIC ACID is utilized in medicinal chemistry for the design and synthesis of novel drug candidates. Its incorporation into molecular structures can enhance the pharmacological properties of these compounds, leading to the development of more effective therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 89598-97-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,5,9 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 89598-97:
(7*8)+(6*9)+(5*5)+(4*9)+(3*8)+(2*9)+(1*7)=220
220 % 10 = 0
So 89598-97-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BBrO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9-11H
