89639-74-7 Usage
Uses
Used in Pharmaceutical Synthesis:
3,4-Dimethylthiophene-2-carboxylic acid is utilized as a building block in the synthesis of pharmaceuticals. Its unique structure and reactivity contribute to the development of various drugs, enhancing their therapeutic properties and effectiveness.
Used in Agrochemical Production:
In the agrochemical industry, 3,4-Dimethylthiophene-2-carboxylic acid serves as a precursor in the development of new chemical compounds. Its incorporation into agrochemical formulations can improve their efficacy in pest control and crop protection.
Used in Material Science:
3,4-Dimethylthiophene-2-carboxylic acid has potential applications in the field of material science. Its unique properties can be leveraged to create novel materials with specific characteristics, such as improved conductivity, stability, or other desirable traits.
Used in Specialty Chemicals Manufacturing:
3,4-Dimethylthiophene-2-carboxylic acid is also employed as a component in the manufacturing of specialty chemicals. Its versatility and reactivity make it suitable for use in the production of various chemical products with specific applications in industries such as cosmetics, fragrances, and coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 89639-74-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,6,3 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 89639-74:
(7*8)+(6*9)+(5*6)+(4*3)+(3*9)+(2*7)+(1*4)=197
197 % 10 = 7
So 89639-74-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c1-4-3-10-6(5(4)2)7(8)9/h3H,1-2H3,(H,8,9)
