89639-74-7 Usage
General Description
3,4-Dimethylthiophene-2-carboxylic acid is a chemical compound with the molecular formula C9H10O2S. It is an organic compound that contains a thiophene ring with two methyl groups and a carboxylic acid functional group. 3,4-Dimethylthiophene-2-carboxylic acid is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its unique properties and reactivity. It can act as a building block in the production of various drugs and serves as a precursor in the development of new chemical compounds. Additionally, 3,4-Dimethylthiophene-2-carboxylic acid has potential applications in the field of material science and as a component in the manufacturing of specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 89639-74-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,6,3 and 9 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 89639-74:
(7*8)+(6*9)+(5*6)+(4*3)+(3*9)+(2*7)+(1*4)=197
197 % 10 = 7
So 89639-74-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c1-4-3-10-6(5(4)2)7(8)9/h3H,1-2H3,(H,8,9)