89894-30-4 Usage
Uses
Used in Pharmaceutical Industry:
1,2,4-Thiadiazol-3-amine, 5-(4-chlorophenyl)is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and biological activity make it a promising candidate for the development of new therapeutic agents.
Used in Agrochemical Industry:
1,2,4-Thiadiazol-3-amine, 5-(4-chlorophenyl)is used in the synthesis of agrochemicals, such as pesticides. Its potential as a pesticide is attributed to its ability to target and control pests, thereby protecting crops and improving agricultural productivity.
Used in Anticancer Research:
1,2,4-Thiadiazol-3-amine, 5-(4-chlorophenyl)is studied for its potential as an anti-cancer agent. Its unique structure and biological activity may contribute to the development of new cancer treatments, offering hope for improved patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 89894-30-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,9,8,9 and 4 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 89894-30:
(7*8)+(6*9)+(5*8)+(4*9)+(3*4)+(2*3)+(1*0)=204
204 % 10 = 4
So 89894-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClN3S/c9-6-3-1-5(2-4-6)7-11-8(10)12-13-7/h1-4H,(H2,10,12)
