90005-77-9 Usage
Uses
Due to the lack of specific information on the uses of 1,2-Benzisoxazole-3-carboxylic acid, 4,5,6,7-tetrahydro-(7CI,9CI), it is difficult to provide a comprehensive list of its applications. However, based on the general properties of benzisoxazole compounds, some potential uses can be inferred:
Used in Organic Chemistry:
1,2-Benzisoxazole-3-carboxylic acid, 4,5,6,7-tetrahydro-(7CI,9CI) may be used as a building block or intermediate in the synthesis of more complex organic molecules. Its unique structure, including the isoxazole and benzene rings, could provide valuable reactivity and selectivity in various chemical reactions.
Used in Pharmaceutical Industry:
As a member of the benzisoxazole family, 1,2-Benzisoxazole-3-carboxylic acid, 4,5,6,7-tetrahydro-(7CI,9CI) could potentially be utilized in the development of pharmaceutical compounds. Its specific properties, such as hydrogen saturation, may contribute to its bioactivity or stability in drug formulations.
Used in Research and Development:
Due to its limited documentation and study, 1,2-Benzisoxazole-3-carboxylic acid, 4,5,6,7-tetrahydro-(7CI,9CI) may serve as a subject of interest for researchers in the fields of organic chemistry and medicinal chemistry. Further investigation into its properties, reactivity, and potential applications could lead to new discoveries and applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 90005-77-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,0,0 and 5 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 90005-77:
(7*9)+(6*0)+(5*0)+(4*0)+(3*5)+(2*7)+(1*7)=99
99 % 10 = 9
So 90005-77-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO3/c10-8(11)7-5-3-1-2-4-6(5)12-9-7/h1-4H2,(H,10,11)
