90203-08-0 Usage
Uses
Used in Pharmaceutical Industry:
(1-Isopropylpyrrolidin-3-yl)methylamine is used as a precursor in the synthesis of pharmaceutical drugs. Its unique structure allows it to be incorporated into the development of new medications, potentially leading to innovative treatments and therapies.
Used in Agrochemical Industry:
In the agrochemical sector, (1-Isopropylpyrrolidin-3-yl)methylamine serves as a precursor in the synthesis of various agrochemicals. This application can contribute to the creation of new pesticides, herbicides, or other agricultural products that enhance crop protection and yield.
Used in Chemical Industry:
(1-Isopropylpyrrolidin-3-yl)methylamine is utilized as a versatile building block in the chemical industry. Its properties and reactivity make it suitable for the synthesis of a wide range of organic molecules, contributing to the development of new chemical products and materials.
Used in Metal Complexation Chemistry:
(1-ISOPROPYLPYRROLIDIN-3-YL)METHYLAMINE can also act as a ligand or chelating agent in metal complexation chemistry. Its ability to form stable complexes with metal ions has potential applications in various fields, such as catalysis, material science, and the development of new coordination compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 90203-08-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,2,0 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 90203-08:
(7*9)+(6*0)+(5*2)+(4*0)+(3*3)+(2*0)+(1*8)=90
90 % 10 = 0
So 90203-08-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N2/c1-7(2)10-4-3-8(5-9)6-10/h7-8H,3-6,9H2,1-2H3
