904-62-1 Usage
Classification
Synthetic chemical compound
Used as an antiprotozoal and antimicrobial agent
3. Molecular structure
Pyridine ring
Two carboxylic acid groups
Side chain containing a carboxy and a carbamoyl group
4. Effectiveness
Treats various parasitic infections
Particularly effective against Pneumocystis jirovecii and Trypanosoma spp.
5. Medical applications
Prevention and treatment of Pneumocystis pneumonia
Particularly useful for patients with weakened immune systems, such as those with HIV/AIDS
6. Mechanism of action
Interferes with the metabolism and DNA synthesis of parasites
Ultimately leading to the death of the parasites
7. Side effects
Can have various side effects
Should only be used under the supervision of a healthcare professional
Check Digit Verification of cas no
The CAS Registry Mumber 904-62-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 9,0 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 904-62:
(5*9)+(4*0)+(3*4)+(2*6)+(1*2)=71
71 % 10 = 1
So 904-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H17N3O7/c15-11(18)2-1-8(12(19)20)16-4-3-7-5-9(13(21)22)17-10(6-7)14(23)24/h3-5,8,10,16H,1-2,6H2,(H2,15,18)(H,19,20)(H,21,22)(H,23,24)/b4-3+/t8-,10-/m0/s1
