90434-19-8 Usage
Uses
Used in Pharmaceutical Industry:
1,3-Dibromo-2,4-dimethylbenzene is utilized as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for versatile reactions and modifications, facilitating the creation of diverse medicinal compounds.
Used in Organic Synthesis:
In the realm of organic chemistry, 1,3-Dibromo-2,4-dimethylbenzene serves as a valuable reagent in various organic reactions. It is particularly employed in cross-coupling reactions such as the Suzuki-Miyaura coupling and the Heck reaction, which are pivotal for constructing complex organic molecules and expanding the scope of synthetic chemistry.
Used in Environmental Monitoring:
Given its potential as an environmental contaminant, 1,3-Dibromo-2,4-dimethylbenzene is also relevant in environmental monitoring and assessment. Understanding its presence and impact in the environment is crucial for ensuring proper handling, disposal, and mitigation strategies to minimize harmful effects on human health and the ecosystem.
Check Digit Verification of cas no
The CAS Registry Mumber 90434-19-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,4,3 and 4 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 90434-19:
(7*9)+(6*0)+(5*4)+(4*3)+(3*4)+(2*1)+(1*9)=118
118 % 10 = 8
So 90434-19-8 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8Br2/c1-5-3-4-7(9)6(2)8(5)10/h3-4H,1-2H3
