90610-57-4 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of biologically active molecules, contributing to the development of new drugs and therapeutic agents.
Used in Agrochemical Synthesis:
In the agrochemical industry, 2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid serves as a valuable building block for the development of pesticides and other agrochemical products. Its versatility enables the synthesis of compounds with targeted biological activity, enhancing crop protection and yield.
Used in Antimicrobial Applications:
2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid has been studied for its potential antimicrobial properties. It can be used as an antimicrobial agent in various applications, such as in the development of new antibiotics or as a preservative in consumer products.
Used in Antifungal Applications:
This chemical compound has also been investigated for its antifungal properties. It can be utilized in the development of antifungal agents, which can be applied in agriculture to protect crops from fungal infections or in medical settings to treat fungal infections in humans.
Used in Material Science:
2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid may have applications in the development of new materials, such as polymers or other advanced materials, due to its unique chemical structure and properties.
Used in Bioconjugation:
The carboxylic acid group present in 2-Ethoxycarbonyl-3-methyl pyrrol-4-carboxylic acid allows for bioconjugation, which is the attachment of biologically active molecules to other molecules or surfaces. This property can be utilized in various applications, such as in the development of biosensors, drug delivery systems, or targeted therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 90610-57-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,6,1 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 90610-57:
(7*9)+(6*0)+(5*6)+(4*1)+(3*0)+(2*5)+(1*7)=114
114 % 10 = 4
So 90610-57-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO4/c1-3-14-9(13)7-5(2)6(4-10-7)8(11)12/h4,10H,3H2,1-2H3,(H,11,12)
90610-57-4Relevant academic research and scientific papers
Imploded bilirubins: Synthesis and properties of 10-nor-mesobilirubin- XIIIα and analogs
Nikitin, Edward B.,Dey, Sanjeev K.,Lightner, David A.
scheme or table, p. 97 - 110 (2010/06/20)
Six 10-nor-bilirubin analogs have been synthesized and investigated. Lacking the C(10) CH2 group, these linear tetrapyrroles have a bipyrrole core rather than a dipyrrylmethane core and thus a different shape. Whereas the propionic acid groups
HETEROCYCLIC AMIDE COMPOUNDS USEFUL AS KINASE INHIBITORS
-
Page/Page column 35; 49, (2008/12/05)
A compound of Formula I and enantiomers, diastereomers and pharmaceutically-acceptable salts thereof. Also disclosed are pharmaceutical compositions containing compounds of Formula I, and methods of treating conditions associated with the activity of p38 kinase.