90993-26-3 Usage
Uses
Used in Pharmaceutical Industry:
Imidazo[4,5-c]pyridine, 7-bromo(7CI,9CI) is used as a building block for the synthesis of complex organic compounds in the pharmaceutical industry. Its unique structure and reactivity make it a valuable component in the development of new drugs and materials.
Used in Research Applications:
In research settings, Imidazo[4,5-c]pyridine, 7-bromo(7CI,9CI) serves as a key intermediate in the synthesis of various organic compounds. Its structural features and potential reactivity make it a promising candidate for exploring new chemical reactions and developing innovative synthetic pathways.
Used in Material Science:
Imidazo[4,5-c]pyridine, 7-bromo(7CI,9CI) may also find applications in material science, where its unique properties can be utilized to create new materials with specific characteristics. Its potential use in the development of advanced materials could contribute to various industries, including electronics, energy, and environmental applications.
Check Digit Verification of cas no
The CAS Registry Mumber 90993-26-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,0,9,9 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 90993-26:
(7*9)+(6*0)+(5*9)+(4*9)+(3*3)+(2*2)+(1*6)=163
163 % 10 = 3
So 90993-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrN3/c7-4-1-8-2-5-6(4)10-3-9-5/h1-3H,(H,9,10)
90993-26-3Relevant academic research and scientific papers
2, 4-DIAMINE-PYRIMIDINE DERIVATIVE AS SERINE/THREONINE KINASE INHIBITORS
-
Page/Page column 46, (2013/07/05)
Compounds having the formula I wherein A, Rla, Rlb, R2, R3, R4, R5, R6, R7, Rs, Ra, Rb, X1, X2, X3 and n are as defined herein are inhibitors of PAK1. Also disclosed are compositions and methods for treating cancer and hyperproliferative disorders
