91-50-9 Usage
General Description
Methyl 2-[[2-methyl-3-[4-(1-methylethyl)phenyl]propylidene]amino]benzoate is a chemical compound that belongs to the class of benzoate esters. It is a derivative of benzoic acid and is commonly used in the production of fragrances and flavorings. methyl 2-[[2-methyl-3-[4-(1-methylethyl)phenyl]propylidene]amino]benzoate is also known for its potential use in pharmaceutical and cosmetic applications due to its aromatic properties. It is typically synthesized through a series of chemical reactions involving the condensation of various precursors, resulting in the formation of the final methyl 2-[[2-methyl-3-[4-(1-methylethyl)phenyl]propylidene]amino]benzoate product.
Check Digit Verification of cas no
The CAS Registry Mumber 91-50-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 9 and 1 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 91-50:
(4*9)+(3*1)+(2*5)+(1*0)=49
49 % 10 = 9
So 91-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H25NO2/c1-15(2)18-11-9-17(10-12-18)13-16(3)14-22-20-8-6-5-7-19(20)21(23)24-4/h5-12,14-16H,13H2,1-4H3/b22-14+