911405-91-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol is used as a building block for the synthesis of other compounds in the pharmaceutical industry. Its unique chemical structure and properties allow it to be incorporated into the development of new drugs and therapeutic agents.
Used in Chemical Industry:
In the chemical industry, 2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol serves as an intermediate for the production of various chemicals. Its versatility and reactivity make it a valuable component in the synthesis of a wide range of chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 911405-91-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,1,1,4,0 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 911405-91:
(8*9)+(7*1)+(6*1)+(5*4)+(4*0)+(3*5)+(2*9)+(1*1)=139
139 % 10 = 9
So 911405-91-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8ClNO/c9-7-4-2-5-1-3-6(11)8(5)10-7/h2,4,6,11H,1,3H2
