91340-38-4 Usage
Uses
Used in Pharmaceutical Industry:
[3-(2-Methoxy-phenoxy)-propyl]-methyl-amine is used as a key intermediate in the synthesis of various pharmaceuticals, particularly those aimed at treating cardiovascular and respiratory conditions. Its unique structure allows for the development of drugs with targeted therapeutic effects.
Used in Organic Chemistry:
[3-(2-METHOXY-PHENOXY)-PROPYL]-METHYL-AMINE serves as a building block in organic chemistry, enabling the creation of more complex molecules with specific properties and functions. Its reactivity and structural features make it a valuable component in the synthesis of advanced organic compounds.
Used in Agrochemical Development:
[3-(2-Methoxy-phenoxy)-propyl]-methyl-amine has potential applications in the development of agrochemicals, where it can be utilized to create novel compounds with improved efficacy and selectivity in agricultural applications.
Used in Materials Science:
In the field of materials science, [3-(2-METHOXY-PHENOXY)-PROPYL]-METHYL-AMINE may contribute to the development of new materials with unique properties, such as enhanced stability, reactivity, or specific interactions with other molecules, making it a promising candidate for various material-based applications.
Check Digit Verification of cas no
The CAS Registry Mumber 91340-38-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,3,4 and 0 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91340-38:
(7*9)+(6*1)+(5*3)+(4*4)+(3*0)+(2*3)+(1*8)=114
114 % 10 = 4
So 91340-38-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H17NO2/c1-12-8-5-9-14-11-7-4-3-6-10(11)13-2/h3-4,6-7,12H,5,8-9H2,1-2H3
