91702-88-4 Usage
Uses
Used in Coordination Chemistry:
3-Pyridinecarboxylicacid, 5-(methylamino)-(9CI) is used as a chelating agent for metal ions in coordination chemistry. Its ability to form stable complexes with metal ions makes it a valuable component in the development of new coordination compounds with potential applications in various fields.
Used in Pharmaceutical Synthesis:
Picolinic acid serves as a precursor for the synthesis of pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic properties. 3-Pyridinecarboxylicacid,5-(methylamino)-(9CI)'s involvement in the metabolism of tryptophan and its potential therapeutic effects in conditions such as diabetes and neurodegenerative diseases make it a promising candidate for the development of novel pharmaceuticals.
Used in Agrochemical Synthesis:
3-Pyridinecarboxylicacid, 5-(methylamino)-(9CI) is also used as a precursor in the synthesis of agrochemicals. Its ability to chelate metal ions and its potential applications in various scientific fields make it a valuable component in the development of new agrochemicals with improved properties and efficacy.
Used in Research and Development:
Picolinic acid is utilized in research and development for its potential therapeutic properties and its role in the metabolism of tryptophan. Studies on its potential effects in conditions such as diabetes and neurodegenerative diseases contribute to the advancement of medical knowledge and the development of new treatment options.
Check Digit Verification of cas no
The CAS Registry Mumber 91702-88-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,1,7,0 and 2 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 91702-88:
(7*9)+(6*1)+(5*7)+(4*0)+(3*2)+(2*8)+(1*8)=134
134 % 10 = 4
So 91702-88-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c1-8-6-2-5(7(10)11)3-9-4-6/h2-4,8H,1H3,(H,10,11)
91702-88-4Relevant academic research and scientific papers
Convenient synthesis of aminopyridinecarboxylic acids
Okamoto, Iwao,Terashima, Masayuki,Yoshioka, Rempei,Muramatsu, Tomonori,Kojima, Satomi,Inoue, Haruka,Takahashi, Mio,Morita, Nobuyoshi,Tamura, Osamu
experimental part, p. 2343 - 2352 (2011/11/06)
6-(Alkylamino)pyridine-2-carboxylic acids and 5-(alkylamino)pyridine-3- carboxylic acids were conveniently synthesized from dibromopyridine in satisfactory yields.
DERIVATIVES OF AMINOPYRIDINECARBOXYLIC ACIDS AND PHARMACEUTICAL COMPOSITIONS CONTAINING THEM
-
, (2008/06/13)
Derivatives of aminopyridinecarboxylic acids which inhibit the dipeptidyl carboxy peptidase (DPCP), methods for their preparation and pharmaceutical compositions containing them.The compounds have formula: STR1 where Z is hydrogen, alkyl having from 1 to 3 carbon atoms, halogen or alkoxy having from 1 to 3 carbon atoms;R1 is hydrogen, alkyl having from 1 to 6 carbon atoms, arylalkyl having from 7 to 12 carbon atoms, aryl having from 6 to 15 carbon atoms;m and n are an integer of from 0 to 4 each provided, however, the m+n is lower than 5;R2 is hydrogen, alkyl having from 1 to 6 carbon atoms or arylalkyl having from 7 to 12 carbon atoms;R3 is hydrogen or acyl having from 1 to 8 carbon atoms;R4 is hydrogen or alkyl having from 1 to 3 carbon atoms;and their pharmaceutically acceptable salts with organic or inorganic acids.
