92-10-4 Usage
General Description
4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde is a chemical compound with the molecular formula C11H14ClNO. It is an aromatic aldehyde derivative that contains a benzene ring with a chlorine-substituted ethylamine group and a methyl group attached to the benzene ring. 4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde is commonly used in the synthesis of pharmaceuticals and organic compounds due to its versatile reactivity and functional groups. It is also known to exhibit various biological activities and is utilized in the development of drugs for treating different medical conditions. Additionally, 4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde is used as an intermediate in organic synthesis and plays a crucial role in the chemical and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 92-10-4 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 9 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 92-10:
(4*9)+(3*2)+(2*1)+(1*0)=44
44 % 10 = 4
So 92-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClNO/c1-3-14(7-6-13)12-5-4-11(9-15)10(2)8-12/h4-5,8-9H,3,6-7H2,1-2H3
