92-10-4 Usage
Uses
Used in Pharmaceutical Synthesis:
4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to react with other compounds to form new medicinal agents. Its unique structure allows for the creation of a wide range of drug candidates with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde serves as a versatile building block for the creation of complex organic compounds. Its functional groups facilitate multiple types of chemical reactions, contributing to the development of novel organic molecules with specific properties and applications.
Used in Drug Development:
4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde is utilized in the development of drugs targeting various medical conditions due to its demonstrated biological activities. Its potential as a therapeutic agent is being explored in preclinical and clinical research, with the aim of identifying new treatments for a range of diseases.
Used in Chemical Industry:
As an intermediate in the chemical industry, 4-((2-Chloroethyl)ethylamino)-2-methylbenzaldehyde plays a crucial role in the production of various chemical products. Its reactivity and functional groups make it an essential component in the synthesis of specialty chemicals, dyes, and other industrial materials.
Check Digit Verification of cas no
The CAS Registry Mumber 92-10-4 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 9 and 2 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 92-10:
(4*9)+(3*2)+(2*1)+(1*0)=44
44 % 10 = 4
So 92-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClNO/c1-3-14(7-6-13)12-5-4-11(9-15)10(2)8-12/h4-5,8-9H,3,6-7H2,1-2H3
