92297-75-1 Usage
Chlorinated derivative
The compound has a chlorine atom (Cl) attached to the carbon chain, making it a chlorinated derivative of the parent compound 1,3,3-trimethyl-1,3-dihydro-indol-2-ylidene-propan-2-one.
Indol-2-ylidene group
The compound contains a heterocyclic ring structure, specifically an indol-2-ylidene group, which is a key structural feature of this chemical.
Organic synthesis reactions
The compound is used in various organic synthesis reactions, making it a valuable intermediate in the preparation of more complex organic compounds.
Potential applications
Due to its unique structure and reactivity, the compound may have applications in pharmaceutical and agrochemical industries as a building block for the synthesis of more complex organic compounds.
Further testing and research
The specific properties and potential uses of this chemical would depend on further testing and research to determine its suitability and effectiveness in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 92297-75-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,2,9 and 7 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 92297-75:
(7*9)+(6*2)+(5*2)+(4*9)+(3*7)+(2*7)+(1*5)=161
161 % 10 = 1
So 92297-75-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H16ClNO/c1-14(2)11-6-4-5-7-12(11)16(3)13(14)8-10(17)9-15/h4-8H,9H2,1-3H3/b13-8-
92297-75-1Relevant academic research and scientific papers
SYNTHESIS OF 3,4-DIHYDROISOXAZOLES - DERIVATIVES OF ω-CARBONYL-SUBSTITUTED 1,3,3-TRIMETHYL-2-METHYLENEINDOLINES AND THEIR CHEMICAL REACTIONS
Tolmachev, A. A.,Babichenko, L. N.,Sheinkman, A. K.
, p. 446 - 451 (2007/10/02)
Stable spiro compounds containing a dihydroisoxazole ring are formed by the reaction of ω-carbonyl-substituted 2-methyleneindolines with hydroxylamine.These compounds are converted in acid media into isoxazoles with scisson of the indoline unit.
