92902-95-9 Usage
Uses
Used in Medicinal Chemistry:
[1-(3-Methoxyphenyl)cyclobutyl]methylamine is used as a building block in drug design for its potential to confer beneficial pharmacological properties. The cyclobutyl ring and methoxyphenyl group may contribute to the compound's bioactivity, while the primary amine group provides a versatile point for further chemical modifications, making it a valuable precursor for the synthesis of other biologically active molecules.
Used in Drug Development:
In the pharmaceutical industry, [1-(3-Methoxyphenyl)cyclobutyl]methylamine is utilized for its potential to enhance the development of new drugs. Its structural components may offer advantages in terms of drug absorption, distribution, metabolism, and excretion, as well as in targeting specific biological pathways or receptors, thus improving the efficacy and selectivity of therapeutic agents.
Further research and exploration into the compound's properties and interactions with biological systems are essential to fully understand and harness its potential in various chemical and medicinal applications. This may lead to the discovery of new therapeutic agents or the improvement of existing ones, ultimately contributing to advancements in healthcare and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 92902-95-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,2,9,0 and 2 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 92902-95:
(7*9)+(6*2)+(5*9)+(4*0)+(3*2)+(2*9)+(1*5)=149
149 % 10 = 9
So 92902-95-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17NO/c1-14-11-5-2-4-10(8-11)12(9-13)6-3-7-12/h2,4-5,8H,3,6-7,9,13H2,1H3
