93049-39-9 Usage
Uses
Used in Pharmaceutical Industry:
PYRIDO[3,4-B]PYRAZINE, 7-CHLOROis used as a building block for the synthesis of various biologically active compounds. Its unique chemical structure and the presence of a chlorine group make it a versatile intermediate for the development of new pharmaceuticals with potential therapeutic applications.
Used in Antimicrobial and Antifungal Applications:
PYRIDO[3,4-B]PYRAZINE, 7-CHLOROhas shown potential as an antimicrobial and antifungal agent in research studies. Its ability to inhibit the growth of harmful microorganisms makes it a promising candidate for the development of new antimicrobial and antifungal agents to combat drug-resistant infections.
Used in Agrochemical Industry:
PYRIDO[3,4-B]PYRAZINE, 7-CHLOROcan be used as a key intermediate in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique properties and reactivity can contribute to the development of more effective and environmentally friendly agrochemicals to protect crops and control pests.
Check Digit Verification of cas no
The CAS Registry Mumber 93049-39-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,0,4 and 9 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 93049-39:
(7*9)+(6*3)+(5*0)+(4*4)+(3*9)+(2*3)+(1*9)=139
139 % 10 = 9
So 93049-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClN3/c8-7-3-5-6(4-11-7)10-2-1-9-5/h1-4H
93049-39-9Relevant academic research and scientific papers
FUSED PYRAZINE DERIVATIVES AS KINASE INHIBITORS
-
Page/Page column 73, (2010/06/11)
A series of quinoxaline derivatives, and analogues thereof, which are functionalised further by a substituted phenyl or pyridinyl moiety, being selective inhibitors of PO kinase enzymes, are accordingly of benefit in medicine, for example in the treatment of inflammatory, autoimmune, cardiovascular, neurodegenerative, metabolic, oncological, nociceptive or ophthalmic conditions.
