93117-07-8 Usage
Uses
Used in Pharmaceutical Industry:
1(2H)-Isoquinolinone, 5-amino-, monohydrochloride is used as a PARP inhibitor compound for its potential therapeutic applications in cancer treatment. As a PARP inhibitor, it can modulate the activity of poly(ADP-ribose) polymerase enzymes, which play a crucial role in DNA repair mechanisms. By inhibiting PARP enzymes, 1(2H)-Isoquinolinone, 5-amino-, monohydrochloride can lead to the accumulation of DNA damage in cancer cells, ultimately resulting in cell death. This makes it a promising candidate for the development of targeted cancer therapies.
Used in Mass Spectrometry Applications:
1(2H)-Isoquinolinone, 5-amino-, monohydrochloride is also utilized in methods for identifying ADP-ribosylated sites by mass spectrometry using Nudex hydrolases. ADP-ribosylation is a post-translational modification that plays a significant role in various cellular processes, including DNA repair, cell signaling, and gene expression regulation. The ability to accurately identify and analyze ADP-ribosylated sites is essential for understanding the molecular mechanisms underlying these processes and can aid in the discovery of novel therapeutic targets and biomarkers.
Check Digit Verification of cas no
The CAS Registry Mumber 93117-07-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,1,1 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 93117-07:
(7*9)+(6*3)+(5*1)+(4*1)+(3*7)+(2*0)+(1*7)=118
118 % 10 = 8
So 93117-07-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O.ClH/c10-8-3-1-2-7-6(8)4-5-11-9(7)12;/h1-5H,10H2,(H,11,12);1H
