93427-13-5 Usage
Uses
Used in the Fragrance Industry:
3,5-Dichlorophenethyl alcohol is used as a fragrance ingredient for its ability to impart a floral, musty scent to products such as soaps, detergents, and perfumes. Its unique aroma profile contributes to the creation of complex and appealing fragrances in these consumer goods.
Used in the Food Industry:
In the food industry, 3,5-DCP serves as a flavoring agent, enhancing the taste profiles of various food products. Its use in this capacity is carefully regulated to ensure safety and quality.
Used in the Pharmaceutical Industry:
3,5-Dichlorophenethyl alcohol is utilized as an intermediate in the production of pharmaceuticals, playing a crucial role in the synthesis of various organic compounds that contribute to the development of new medications.
Used in Antimicrobial Applications:
3,5-DCP has demonstrated potential as an antimicrobial agent, making it a candidate for use in the treatment of infections. Its ability to combat microbial growth could be harnessed in various applications where controlling the spread of pathogens is essential.
However, it is important to note that 3,5-DCP should be handled with care due to its potential to cause irritation to the skin, eyes, and respiratory system. Additionally, it is toxic if ingested or inhaled in large quantities, necessitating proper safety measures during its use and production.
Check Digit Verification of cas no
The CAS Registry Mumber 93427-13-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,4,2 and 7 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 93427-13:
(7*9)+(6*3)+(5*4)+(4*2)+(3*7)+(2*1)+(1*3)=135
135 % 10 = 5
So 93427-13-5 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8Cl2O/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5,11H,1-2H2
