93567-90-9 Usage
Uses
Used in Fragrance and Flavoring Industry:
4-butoxy-3-ethoxy-benzaldehyde is used as a key ingredient in the fragrance and flavoring industry for its distinctive aromatic properties. It imparts pleasant scents and tastes to a wide range of products, including perfumes, cosmetics, and food items.
Used in Pharmaceutical Synthesis:
4-butoxy-3-ethoxy-benzaldehyde serves as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic benefits. It plays a crucial role in the production of medications that address a variety of health conditions.
Used in Agrochemical Production:
In the agrochemical industry, 4-butoxy-3-ethoxy-benzaldehyde is utilized as an intermediate in the synthesis of various agrochemicals. Its chemical properties make it suitable for the development of pesticides, herbicides, and other agricultural chemicals that help protect crops and enhance agricultural productivity.
Safety Considerations:
4-butoxy-3-ethoxy-benzaldehyde is considered to be a potentially hazardous chemical. Due to its potential health and environmental risks, it should be handled with caution. Proper safety measures, including the use of personal protective equipment and adherence to safety protocols, are essential when working with 4-butoxy-3-ethoxy-benzaldehyde to minimize risks and ensure the well-being of individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 93567-90-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,5,6 and 7 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 93567-90:
(7*9)+(6*3)+(5*5)+(4*6)+(3*7)+(2*9)+(1*0)=169
169 % 10 = 9
So 93567-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O3/c1-3-5-8-16-12-7-6-11(10-14)9-13(12)15-4-2/h6-7,9-10H,3-5,8H2,1-2H3
