936940-62-4 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
3-(2-Hydroxyethyl)piperazin-2-one is used as a reagent for the synthesis of various pharmaceuticals and agrochemicals due to its versatile reactivity and high stability. Its unique structure allows for the formation of a wide range of compounds with potential therapeutic and pesticidal properties.
Used in Corrosion Inhibition:
3-(2-Hydroxyethyl)piperazin-2-one is studied for its potential as a corrosion inhibitor. Its ability to form protective films on metal surfaces can help prevent corrosion, making it a valuable additive in various industrial applications.
Used in Coordination Chemistry as a Ligand:
3-(2-Hydroxyethyl)piperazin-2-one has been studied for its potential as a ligand in coordination chemistry. Its ability to form stable complexes with metal ions can be utilized in the development of new materials with specific properties, such as catalysts, sensors, and magnetic materials.
Check Digit Verification of cas no
The CAS Registry Mumber 936940-62-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 9,3,6,9,4 and 0 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 936940-62:
(8*9)+(7*3)+(6*6)+(5*9)+(4*4)+(3*0)+(2*6)+(1*2)=204
204 % 10 = 4
So 936940-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O2/c9-4-1-5-6(10)8-3-2-7-5/h5,7,9H,1-4H2,(H,8,10)
936940-62-4Relevant academic research and scientific papers
NICOTINIC ACETYLCHOLINE RECEPTOR LIGANDS
-
Page/Page column 13, (2010/02/12)
Acetylcholine receptor ligands of formula (I), wherein D, Ar1, E and Ar2 are as described in the specification, diastereoisomers, enantiomers, pharmaceutically-acceptable salts, methods of making, pharmaceutical compositions containing and methods for usi
