93930-25-7 Usage
Description
3,5-Dichloro-DL-Phenylalanine is a synthetic derivative of the amino acid phenylalanine, featuring two chlorine atoms attached to its structure. This chemical compound is of interest to chemists and researchers due to its potential applications in pharmaceuticals, chemical synthesis, and drug development.
Used in Pharmaceutical Industry:
3,5-Dichloro-DL-Phenylalanine is used as a building block for the synthesis of complex molecules, contributing to the development of new drugs and pharmaceuticals. Its unique properties, including the presence of chlorine atoms, may offer specific advantages in the design and function of these medicinal compounds.
Used in Chemical Research:
In the field of chemical research, 3,5-Dichloro-DL-Phenylalanine serves as a valuable compound for studying the effects of chlorine substitution on the properties and reactivity of amino acids and their derivatives. This can lead to a better understanding of molecular interactions and the development of novel chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 93930-25-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,3 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 93930-25:
(7*9)+(6*3)+(5*9)+(4*3)+(3*0)+(2*2)+(1*5)=147
147 % 10 = 7
So 93930-25-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2NO2/c10-6-1-5(2-7(11)4-6)3-8(12)9(13)14/h1-2,4,8H,3,12H2,(H,13,14)/t8-/m0/s1
93930-25-7Relevant articles and documents
Telescopic one-pot condensation-hydroamination strategy for the synthesis of optically pure L-phenylalanines from benzaldehydes
Parmeggiani, Fabio,Ahmed, Syed T.,Weise, Nicholas J.,Turner, Nicholas J.
, p. 7256 - 7262 (2016/10/26)
A chemo-enzymatic telescopic approach was designed for the synthesis of L-arylalanines in high yield and optical purity, starting from commercially available and inexpensive substituted benzaldehydes. The method exploits a chemical Knoevenagel–Doebner condensation (optimised to give complete conversions in a short reaction time, employing microwave irradiation) and a biocatalytic phenylalanine ammonia lyase mediated hydroamination (for the stereoselective addition of ammonia). The two reactions can be run sequentially in one pot, bringing together the advantages of chemical and biological catalysis. The preparative applicability was demonstrated with the synthesis of five L-dihalophenylalanines (71–84% yield, 98–99% ee) of relevance as molecular probes, for medicinal chemistry and for the synthesis of pharmaceutical ingredients.
