93957-52-9 Usage
General Description
3-Methyl(E)-7-[3-(4-fluorophenyl)-1-methylethyl-indol-2-yl]-3-hydroxy-5-oxohept-6-enoate is a chemical compound with a complex structure. It contains a 3-methyl, 7-[3-(4-fluorophenyl)-1-methylethyl-indol-2-yl]-3-hydroxy-5-oxohept-6-enoate group, which is a combination of various functional groups including alkyl, phenyl, and hydroxyl groups. 3-Methyl(E)-7-[3-(4-fluorophenyl)-1-methylethyl-indol-2-yl]-3-hydroxy-5-oxohept-6-enoate may have potential pharmaceutical or medical applications due to its unique structure and functional groups. Further research and analysis are needed to fully understand the properties and potential uses of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 93957-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,3,9,5 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 93957-52:
(7*9)+(6*3)+(5*9)+(4*5)+(3*7)+(2*5)+(1*2)=179
179 % 10 = 9
So 93957-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C25H26FNO4/c1-16(2)27-22-7-5-4-6-21(22)25(17-8-10-18(26)11-9-17)23(27)13-12-19(28)14-20(29)15-24(30)31-3/h4-13,16,19,28H,14-15H2,1-3H3/b13-12+