94084-62-5 Usage
Uses
Used in Pharmaceutical Industry:
2-Furancarboxylic acid, 5-methoxy-(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and potential biological activity make it a valuable component in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Furancarboxylic acid, 5-methoxy-(9CI) serves as a building block for the creation of novel agrochemicals. Its properties may contribute to the development of more effective and environmentally friendly pesticides or herbicides.
Used in Materials Science:
2-Furancarboxylic acid, 5-methoxy-(9CI) is utilized in materials science for the development of advanced materials with specific properties. Its incorporation into polymers or other materials could enhance their performance in various applications.
Used in Drug Discovery and Development:
Due to its potential biological activity, 2-Furancarboxylic acid, 5-methoxy-(9CI) is employed in drug discovery and development processes. It may serve as a lead compound for the design of new therapeutic agents targeting various diseases and conditions.
Further research is necessary to fully understand the capabilities and potential applications of 2-Furancarboxylic acid, 5-methoxy-(9CI), ensuring its safe and effective use across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 94084-62-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 9,4,0,8 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 94084-62:
(7*9)+(6*4)+(5*0)+(4*8)+(3*4)+(2*6)+(1*2)=145
145 % 10 = 5
So 94084-62-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6O4/c1-9-5-3-2-4(10-5)6(7)8/h2-3H,1H3,(H,7,8)
